ChemNet > CAS > 501-24-6 3-n-Pentadecylphenol
501-24-6 3-n-Pentadecylphenol
| product Name |
3-n-Pentadecylphenol |
| CAS No |
501-24-6 |
| Synonyms |
Pentadecylphenol; 3-pentadecylphenol; 3-Pentadecyl phenol |
| Molecular Formula |
C21H36O |
| Molecular Weight |
304.5099 |
| InChI |
InChI=1/C21H36O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-20-17-15-18-21(22)19-20/h15,17-19,22H,2-14,16H2,1H3 |
| EINECS |
207-921-9 |
| Molecular Structure |
|
| Density |
0.908g/cm3 |
| Melting point |
47-53℃ |
| Boiling point |
402°C at 760 mmHg |
| Refractive index |
1.495 |
| Flash point |
246.3°C |
| Vapour Pressur |
4.88E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
