ChemNet > CAS > 501435-91-2 5-Bromo-2-fluoropyridine-3-boronic acid
501435-91-2 5-Bromo-2-fluoropyridine-3-boronic acid
| product Name |
5-Bromo-2-fluoropyridine-3-boronic acid |
| CAS No |
501435-91-2 |
| Synonyms |
5-Bromo-2-fluoro-3-pyridylboronic acid; (5-bromo-2-fluoropyridin-3-yl)boronic acid; 2-Fluoro-5-Bromopyridine-3-Boronic Acid |
| Molecular Formula |
C5H4BBrFNO2 |
| Molecular Weight |
219.8042 |
| InChI |
InChI=1/C5H4BBrFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H |
| Molecular Structure |
|
| Density |
1.86g/cm3 |
| Boiling point |
357.1°C at 760 mmHg |
| Refractive index |
1.574 |
| Flash point |
169.7°C |
| Vapour Pressur |
1.02E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
