ChemNet > CAS > 50269-95-9 1H-pyrrole-2-carbohydrazide
50269-95-9 1H-pyrrole-2-carbohydrazide
| product Name |
1H-pyrrole-2-carbohydrazide |
| CAS No |
50269-95-9 |
| Molecular Formula |
C5H7N3O |
| Molecular Weight |
125.1286 |
| InChI |
InChI=1/C5H7N3O/c6-8-5(9)4-2-1-3-7-4/h1-3,7H,6H2,(H,8,9) |
| Molecular Structure |
|
| Density |
1.313g/cm3 |
| Melting point |
231℃ |
| Refractive index |
1.614 |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
