ChemNet > CAS > 504-08-5 2,4-Diamino-s-triazine
504-08-5 2,4-Diamino-s-triazine
| product Name |
2,4-Diamino-s-triazine |
| CAS No |
504-08-5 |
| Synonyms |
Diaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-Diamino-1,3,5-Triazine |
| Molecular Formula |
C3H5N5 |
| Molecular Weight |
111.1053 |
| InChI |
InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
| EINECS |
207-983-7 |
| Molecular Structure |
|
| Density |
1.508g/cm3 |
| Boiling point |
447.6°C at 760 mmHg |
| Refractive index |
1.716 |
| Flash point |
254.9°C |
| Vapour Pressur |
3.32E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
