ChemNet > CAS > 504-20-1 phorone
504-20-1 phorone
| product Name |
phorone |
| CAS No |
504-20-1 |
| Synonyms |
2,6-Dimethyl-2,5-heptadien-4-one; Diisopropyllideneacetone; 2,6-dimethylhepta-2,5-dien-4-one |
| Molecular Formula |
C9H14O |
| Molecular Weight |
138.2069 |
| InChI |
InChI=1/C9H14O/c1-7(2)5-9(10)6-8(3)4/h5-6H,1-4H3 |
| EINECS |
207-986-3 |
| Molecular Structure |
|
| Density |
0.858g/cm3 |
| Melting point |
23-26℃ |
| Boiling point |
198.5°C at 760 mmHg |
| Refractive index |
1.453 |
| Flash point |
79.4°C |
| Vapour Pressur |
0.358mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
