ChemNet > CAS > 504-57-4 10-Nonadecanone
504-57-4 10-Nonadecanone
| product Name |
10-Nonadecanone |
| CAS No |
504-57-4 |
| Synonyms |
Di-n-nonyl ketone; nonadecan-10-one |
| Molecular Formula |
C19H38O |
| Molecular Weight |
282.5044 |
| InChI |
InChI=1/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
| EINECS |
207-994-7 |
| Molecular Structure |
|
| Density |
0.832g/cm3 |
| Melting point |
55-57℃ |
| Boiling point |
351.2°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
81.6°C |
| Vapour Pressur |
4.17E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
