ChemNet > CAS > 50440-82-9 2-Amino-6-methyl-4(3H)-quinazolone
50440-82-9 2-Amino-6-methyl-4(3H)-quinazolone
| product Name |
2-Amino-6-methyl-4(3H)-quinazolone |
| CAS No |
50440-82-9 |
| Synonyms |
2-amino-6-methylquinazolin-4(1H)-one |
| Molecular Formula |
C9H9N3O |
| Molecular Weight |
175.1873 |
| InChI |
InChI=1/C9H9N3O/c1-5-2-3-7-6(4-5)8(13)12-9(10)11-7/h2-4H,1H3,(H3,10,11,12,13) |
| Molecular Structure |
|
| Density |
1.42g/cm3 |
| Boiling point |
386.5°C at 760 mmHg |
| Refractive index |
1.701 |
| Flash point |
187.5°C |
| Vapour Pressur |
3.54E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
