ChemNet > CAS > 5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
5081-37-8 Methyl 3-methoxy-4-nitrobenzoate
product Name |
Methyl 3-methoxy-4-nitrobenzoate |
Synonyms |
3-Methoxy-4-nitrobenzoic acid methyl ester; acid methyl ester |
Molecular Formula |
C9H9NO5 |
Molecular Weight |
211.1715 |
InChI |
InChI=1/C9H9NO5/c1-14-8-5-6(9(11)15-2)3-4-7(8)10(12)13/h3-5H,1-2H3 |
CAS Registry Number |
5081-37-8 |
Molecular Structure |
|
Density |
1.294g/cm3 |
Melting point |
86-88℃ |
Boiling point |
350.7°C at 760 mmHg |
Refractive index |
1.54 |
Flash point |
168.3°C |
Vapour Pressur |
4.3E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|