ChemNet > CAS > 50907-21-6 5-(4-Fluorophenyl)-1H-tetrazole
50907-21-6 5-(4-Fluorophenyl)-1H-tetrazole
| product Name |
5-(4-Fluorophenyl)-1H-tetrazole |
| CAS No |
50907-21-6 |
| Synonyms |
5-(4-fluorophenyl)-2H-tetrazole |
| Molecular Formula |
C7H5FN4 |
| Molecular Weight |
164.1398 |
| InChI |
InChI=1/C7H5FN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
| Molecular Structure |
|
| Density |
1.403g/cm3 |
| Boiling point |
322°C at 760 mmHg |
| Refractive index |
1.591 |
| Flash point |
148.5°C |
| Vapour Pressur |
0.000288mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
