ChemNet > CAS > 50920-65-5 1-Ethyl-3-methyl-1H-pyrazole-5-carboxylic acid
50920-65-5 1-Ethyl-3-methyl-1H-pyrazole-5-carboxylic acid
| product Name |
1-Ethyl-3-methyl-1H-pyrazole-5-carboxylic acid |
| CAS No |
50920-65-5 |
| Synonyms |
Ethylmethylpyrazolecarboxylicacid; 1-ethyl-3-methyl-1H-pyrazole-5-carboxylate |
| Molecular Formula |
C7H9N2O2 |
| Molecular Weight |
153.1591 |
| InChI |
InChI=1/C7H10N2O2/c1-3-9-6(7(10)11)4-5(2)8-9/h4H,3H2,1-2H3,(H,10,11)/p-1 |
| Molecular Structure |
|
| Melting point |
137-140℃ |
| Boiling point |
308.5°C at 760 mmHg |
| Flash point |
140.4°C |
| Vapour Pressur |
0.000293mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
