ChemNet > CAS > 50998-17-9 6-bromoquinoxaline
50998-17-9 6-bromoquinoxaline
| product Name |
6-bromoquinoxaline |
| CAS No |
50998-17-9 |
| Synonyms |
Quinoxaline, 6-bromo- |
| Molecular Formula |
C8H5BrN2 |
| Molecular Weight |
209.0427 |
| InChI |
InChI=1/C8H5BrN2/c9-6-1-2-7-8(5-6)11-4-3-10-7/h1-5H |
| Molecular Structure |
|
| Density |
1.656g/cm3 |
| Melting point |
53℃ |
| Boiling point |
300.2°C at 760 mmHg |
| Refractive index |
1.685 |
| Flash point |
135.4°C |
| Vapour Pressur |
0.00203mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
