ChemNet > CAS > 51011-54-2 1-(6-chloro-1,3-benzothiazol-2-yl)hydrazine
51011-54-2 1-(6-chloro-1,3-benzothiazol-2-yl)hydrazine
| product Name |
1-(6-chloro-1,3-benzothiazol-2-yl)hydrazine |
| CAS No |
51011-54-2 |
| Synonyms |
(6-Chloro-benzothiazol-2-yl)-hydrazine; 6-chloro-2-hydrazinyl-1,3-benzothiazole; (6-chlorobenzothiazol-2-yl)hydrazine; 6-chloro-2-hydrazino-benzothiazole; 1,2-Hydrazino-6-chlorobenzothiazole; F1908-0017; (6-chloro-1,3-benzothiazol-2-yl)hydrazine |
| Molecular Formula |
C7H6ClN3S |
| Molecular Weight |
199.6606 |
| InChI |
InChI=1/C7H6ClN3S/c8-4-1-2-5-6(3-4)12-7(10-5)11-9/h1-3H,9H2,(H,10,11) |
| Molecular Structure |
|
| Density |
1.599g/cm3 |
| Melting point |
212℃ |
| Boiling point |
361.293°C at 760 mmHg |
| Refractive index |
1.813 |
| Flash point |
172.304°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
