ChemNet > CAS > 51135-96-7 4-Benzyl-4-hydroxypiperidine
51135-96-7 4-Benzyl-4-hydroxypiperidine
| product Name |
4-Benzyl-4-hydroxypiperidine |
| CAS No |
51135-96-7 |
| Synonyms |
4-Benzyl-4-piperidinol; 4-benzylpiperidin-4-ol; 4-benzyl-4-hydroxypiperidinium |
| Molecular Formula |
C12H18NO |
| Molecular Weight |
192.2769 |
| InChI |
InChI=1/C12H17NO/c14-12(6-8-13-9-7-12)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2/p+1 |
| EINECS |
257-003-7 |
| Molecular Structure |
|
| Melting point |
80-85℃ |
| Boiling point |
329°C at 760 mmHg |
| Flash point |
128.4°C |
| Vapour Pressur |
7.37E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
