ChemNet > CAS > 51329-15-8 Methyl 3,5-dibromobenzoate
51329-15-8 Methyl 3,5-dibromobenzoate
| product Name |
Methyl 3,5-dibromobenzoate |
| CAS No |
51329-15-8 |
| Synonyms |
3,5-Dibromobenzoic acid methyl ester; 3,5-DIBROMOMETHYLBENZOATE; RARECHEM AL BF 0770 |
| Molecular Formula |
C8H6Br2O2 |
| Molecular Weight |
293.94 |
| InChI |
InChI=1/C8H6Br2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3 |
| Molecular Structure |
|
| Density |
1.84g/cm3 |
| Melting point |
61-64℃ |
| Boiling point |
294.2°C at 760 mmHg |
| Refractive index |
1.583 |
| Flash point |
131.8°C |
| Vapour Pressur |
0.00164mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
