ChemNet > CAS > 51362-38-0 6-phenoxynicotinic acid
51362-38-0 6-phenoxynicotinic acid
| product Name |
6-phenoxynicotinic acid |
| CAS No |
51362-38-0 |
| Synonyms |
6-phenoxypyridine-3-carboxylic acid |
| Molecular Formula |
C12H9NO3 |
| Molecular Weight |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12(15)9-6-7-11(13-8-9)16-10-4-2-1-3-5-10/h1-8H,(H,14,15) |
| Molecular Structure |
|
| Density |
1.298g/cm3 |
| Melting point |
164℃ |
| Boiling point |
391.2°C at 760 mmHg |
| Refractive index |
1.613 |
| Flash point |
190.4°C |
| Vapour Pressur |
8.03E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
