ChemNet > CAS > 51376-06-8 5-bromo-2,1,3-benzoxadiazole
51376-06-8 5-bromo-2,1,3-benzoxadiazole
| product Name |
5-bromo-2,1,3-benzoxadiazole |
| CAS No |
51376-06-8 |
| Synonyms |
5-bromobenzo[c][1,2,5]oxadiazole |
| Molecular Formula |
C6H3BrN2O |
| Molecular Weight |
199.0048 |
| InChI |
InChI=1/C6H3BrN2O/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H |
| Molecular Structure |
|
| Density |
1.826g/cm3 |
| Melting point |
73℃ |
| Boiling point |
255.778°C at 760 mmHg |
| Refractive index |
1.661 |
| Flash point |
108.491°C |
| Vapour Pressur |
0.026mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
