ChemNet > CAS > 5139-89-9 4-Phenoxybutyryl chloride
5139-89-9 4-Phenoxybutyryl chloride
| product Name |
4-Phenoxybutyryl chloride |
| CAS No |
5139-89-9 |
| Synonyms |
4-phenoxybutanoyl chloride |
| Molecular Formula |
C10H11ClO2 |
| Molecular Weight |
198.6461 |
| InChI |
InChI=1/C10H11ClO2/c11-10(12)7-4-8-13-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| EINECS |
225-903-9 |
| Molecular Structure |
|
| Density |
1.158g/cm3 |
| Boiling point |
297.1°C at 760 mmHg |
| Refractive index |
1.515 |
| Flash point |
110.6°C |
| Vapour Pressur |
0.00138mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
