ChemNet > CAS > 5142-22-3 1-Methyladenine
5142-22-3 1-Methyladenine
| product Name |
1-Methyladenine |
| CAS No |
5142-22-3 |
| Synonyms |
6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-Methyl-1H-purin-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purin-6-imine |
| Molecular Formula |
C6H7N5 |
| Molecular Weight |
149.1533 |
| InChI |
InChI=1/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| EINECS |
225-907-0 |
| Molecular Structure |
|
| Density |
1.607g/cm3 |
| Melting point |
300℃ |
| Boiling point |
415.879°C at 760 mmHg |
| Refractive index |
1.807 |
| Flash point |
205.317°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
