ChemNet > CAS > 51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
51560-21-5 Benzene, 1,4-diiodo-2,5-dimethoxy-
| product Name |
Benzene, 1,4-diiodo-2,5-dimethoxy- |
| CAS No |
51560-21-5 |
| Synonyms |
1,4-Diiodo-2,5-dimethoxybenzene |
| Molecular Formula |
C8H8I2O2 |
| Molecular Weight |
389.9569 |
| InChI |
InChI=1/C8H8I2O2/c1-11-7-3-6(10)8(12-2)4-5(7)9/h3-4H,1-2H3 |
| Molecular Structure |
|
| Density |
2.147g/cm3 |
| Melting point |
171℃ |
| Boiling point |
382.9°C at 760 mmHg |
| Refractive index |
1.64 |
| Flash point |
185.4°C |
| Vapour Pressur |
1.01E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
