ChemNet > CAS > 51605-97-1 4-Amino-2-bromocumene
51605-97-1 4-Amino-2-bromocumene
| product Name |
4-Amino-2-bromocumene |
| CAS No |
51605-97-1 |
| Synonyms |
2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
| Molecular Formula |
C9H12BrN |
| Molecular Weight |
214.1023 |
| InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.355g/cm3 |
| Boiling point |
271.8°C at 760 mmHg |
| Refractive index |
1.577 |
| Flash point |
118.2°C |
| Vapour Pressur |
0.00631mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
