ChemNet > CAS > 51660-08-3 5-chloro-6-phenylpyridazin-3-ol
51660-08-3 5-chloro-6-phenylpyridazin-3-ol
| product Name |
5-chloro-6-phenylpyridazin-3-ol |
| CAS No |
51660-08-3 |
| Synonyms |
5-chloro-2-methyl-6-phenylpyridazin-3(2H)-one; 5-chloro-6-phenylpyridazin-3(2H)-one |
| Molecular Formula |
C10H7ClN2O |
| Molecular Weight |
206.6284 |
| InChI |
InChI=1/C10H7ClN2O/c11-8-6-9(14)12-13-10(8)7-4-2-1-3-5-7/h1-6H,(H,12,14) |
| Molecular Structure |
|
| Density |
1.35g/cm3 |
| Melting point |
235℃ |
| Boiling point |
403.2°C at 760 mmHg |
| Refractive index |
1.641 |
| Flash point |
197.7°C |
| Vapour Pressur |
4.44E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
