ChemNet > CAS > 5170-68-3 2,1,3-benzothiadiazole-4-carbaldehyde
5170-68-3 2,1,3-benzothiadiazole-4-carbaldehyde
| product Name |
2,1,3-benzothiadiazole-4-carbaldehyde |
| CAS No |
5170-68-3 |
| Molecular Formula |
C7H4N2OS |
| Molecular Weight |
164.1845 |
| InChI |
InChI=1/C7H4N2OS/c10-4-5-2-1-3-6-7(5)9-11-8-6/h1-4H |
| Molecular Structure |
|
| Density |
1.477g/cm3 |
| Melting point |
101℃ |
| Boiling point |
291.9°C at 760 mmHg |
| Refractive index |
1.752 |
| Flash point |
130.3°C |
| Vapour Pressur |
0.0019mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
