ChemNet > CAS > 51801-69-5 4-(m-Tolyloxy)-toluene
51801-69-5 4-(m-Tolyloxy)-toluene
| product Name |
4-(m-Tolyloxy)-toluene |
| CAS No |
51801-69-5 |
| Synonyms |
3,4-Dimethyldiphenyl ether; 1-methyl-3-(4-methylphenoxy)benzene |
| Molecular Formula |
C14H14O |
| Molecular Weight |
198.2604 |
| InChI |
InChI=1/C14H14O/c1-11-6-8-13(9-7-11)15-14-5-3-4-12(2)10-14/h3-10H,1-2H3 |
| Molecular Structure |
|
| Density |
1.029g/cm3 |
| Boiling point |
285.8°C at 760 mmHg |
| Refractive index |
1.56 |
| Flash point |
121.5°C |
| Vapour Pressur |
0.00471mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
