ChemNet > CAS > 51805-45-9 Tris-(2-carboxyethyl)-phosphine hydrochloride
51805-45-9 Tris-(2-carboxyethyl)-phosphine hydrochloride
| product Name |
Tris-(2-carboxyethyl)-phosphine hydrochloride |
| Synonyms |
Tris(2-carboxyethyl)phosphine hydrochloride; 3,3',3''-phosphanetriyltripropanoic acid hydrochloride; 3,3',3''-phosphanetriyltripropanoate |
| Molecular Formula |
C9H12O6P |
| Molecular Weight |
247.1634 |
| InChI |
InChI=1/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15)/p-3 |
| CAS Registry Number |
51805-45-9 |
| Molecular Structure |
|
| Boiling point |
519.4°C at 760 mmHg |
| Flash point |
267.9°C |
| Vapour Pressur |
3.51E-12mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Tris-(2-carboxyethyl)-phosphine hydrochloride Material Safety Data Sheet
|
|
