ChemNet > CAS > 51873-95-1 3-Bromobenzaldehyde oxime
51873-95-1 3-Bromobenzaldehyde oxime
| product Name |
3-Bromobenzaldehyde oxime |
| CAS No |
51873-95-1 |
| Synonyms |
3-Bromobenzaldoxime |
| Molecular Formula |
C7H6BrNO |
| Molecular Weight |
200.0326 |
| InChI |
InChI=1/C7H6BrNO/c8-7-3-1-2-6(4-7)5-9-10/h1-5,10H/b9-5- |
| Molecular Structure |
|
| Density |
1.52g/cm3 |
| Melting point |
73-76℃ |
| Boiling point |
266.7°C at 760 mmHg |
| Refractive index |
1.581 |
| Flash point |
115.1°C |
| Vapour Pressur |
0.00423mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
