ChemNet > CAS > 51980-54-2 4-(1-Pyrrolidinyl)-benzaldehyde
51980-54-2 4-(1-Pyrrolidinyl)-benzaldehyde
| product Name |
4-(1-Pyrrolidinyl)-benzaldehyde |
| CAS No |
51980-54-2 |
| Synonyms |
4-(1-Pyrrolidino)benzaldehyde; 4-(pyrrolidin-1-yl)benzaldehyde |
| Molecular Formula |
C11H13NO |
| Molecular Weight |
175.227 |
| InChI |
InChI=1/C11H13NO/c13-9-10-3-5-11(6-4-10)12-7-1-2-8-12/h3-6,9H,1-2,7-8H2 |
| EINECS |
257-570-0 |
| Molecular Structure |
|
| Density |
1.125g/cm3 |
| Boiling point |
329.4°C at 760 mmHg |
| Refractive index |
1.599 |
| Flash point |
134.3°C |
| Vapour Pressur |
0.000178mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
