ChemNet > CAS > 520-03-6 N-phenylphthalimide
520-03-6 N-phenylphthalimide
| product Name |
N-phenylphthalimide |
| CAS No |
520-03-6 |
| Synonyms |
2-PHENYL-ISOINDOLE-1,3-DIONE; PHTHALANIL; 1H-Isoindole-1,3(2H)-dione, 2-phenyl-; 1H-Isoindole-1,3(2H)-dione,2-phenyl-; 2-Phenyl-1,3-isoindoledione; 2-Phenyl-1,3-isoindolinedione; 2-Phenyl-1H-isoindole-1,3(2H)-dione; 2-phenyl-1h-isoindole-3(2h)-dione; n-phenyl-phthalimid; Phthalimide, N-phenyl-; Phthalimide,N-phenyl-; Phenylphthalimide; N-phenyl phthalimide |
| Molecular Formula |
C14H9NO2 |
| Molecular Weight |
223.2268 |
| InChI |
InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H |
| EINECS |
208-282-9 |
| Molecular Structure |
|
| Density |
1.338g/cm3 |
| Melting point |
204-207℃ |
| Boiling point |
388.8°C at 760 mmHg |
| Refractive index |
1.667 |
| Flash point |
182.6°C |
| Vapour Pressur |
2.99E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
