ChemNet > CAS > 52075-14-6 (4S,5S)-(-)-4-Methoxymethyl-2-methyl-5-phenyl-2-oxazoline
52075-14-6 (4S,5S)-(-)-4-Methoxymethyl-2-methyl-5-phenyl-2-oxazoline
| product Name |
(4S,5S)-(-)-4-Methoxymethyl-2-methyl-5-phenyl-2-oxazoline |
| CAS No |
52075-14-6 |
| Synonyms |
(4S,5S)-()-4,5-Dihydro-4-methoxymethyl-2-methyl-5-phenyloxazole; Methoxymethylmethylphenyoxazoline; 4-(methoxymethyl)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazole; (4S,5S)-4-(methoxymethyl)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazole; (4R,5S)-4-(methoxymethyl)-2-methyl-5-phenyl-4,5-dihydro-1,3-oxazole |
| Molecular Formula |
C12H15NO2 |
| Molecular Weight |
205.253 |
| InChI |
InChI=1/C12H15NO2/c1-9-13-11(8-14-2)12(15-9)10-6-4-3-5-7-10/h3-7,11-12H,8H2,1-2H3/t11-,12+/m1/s1 |
| EINECS |
257-641-6 |
| Molecular Structure |
|
| Density |
1.11g/cm3 |
| Boiling point |
325.7°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
107.3°C |
| Vapour Pressur |
0.000429mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
