ChemNet > CAS > 37317-82-1 2-acetoxybenzoic acid; N-(4-ethoxyphenyl)acetamide; 1,3,7-trimethylpurine-2,6-dione
37317-82-1 2-acetoxybenzoic acid; N-(4-ethoxyphenyl)acetamide; 1,3,7-trimethylpurine-2,6-dione
| product Name |
2-acetoxybenzoic acid; N-(4-ethoxyphenyl)acetamide; 1,3,7-trimethylpurine-2,6-dione |
| CAS No |
37317-82-1;52081-01-3;8003-03-0;8074-12-2;91925-29-0 |
| Synonyms |
A.P.C; APC; Aspirin, Phenacetin and Caffeine; ASPIRIN, PHENACETIN, CAFFEINE; Benzoic acid, 2-(acetyloxy)-, mixed with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione, and N-(4-ethoxyphenyl)acetamide; Benzoic acid, 2-(acetyloxy)-, mixt. with 3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione and N-(4-ethoxyphenyl)acetamide; P-A-C Compound |
| Molecular Formula |
C27H31N5O8 |
| Molecular Weight |
553.5637 |
| InChI |
InChI=1/C10H13NO2.C9H8O4.C8H10N4O2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12;1-6(10)13-8-5-3-2-4-7(8)9(11)12;1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4-7H,3H2,1-2H3,(H,11,12);2-5H,1H3,(H,11,12);4H,1-3H3 |
| Molecular Structure |
|
| Boiling point |
416.8°C at 760 mmHg |
| Flash point |
205.9°C |
| Vapour Pressur |
3.72E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
