ChemNet > CAS > 5211-62-1 2-Methoxyphenylacetone
5211-62-1 2-Methoxyphenylacetone
| product Name |
2-Methoxyphenylacetone |
| CAS No |
5211-62-1 |
| Synonyms |
2-Methoxybenzyl methyl ketone; 1-(2-Methoxyphenyl)-2-propanone; 1-(2-methoxyphenyl)propan-2-one |
| Molecular Formula |
C10H12O2 |
| Molecular Weight |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,7H2,1-2H3 |
| EINECS |
226-008-6 |
| Molecular Structure |
|
| Density |
1.027g/cm3 |
| Melting point |
127-130℃ (10 mmHg) |
| Boiling point |
261.7°C at 760 mmHg |
| Refractive index |
1.501 |
| Flash point |
94°C |
| Vapour Pressur |
0.0114mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
