ChemNet > CAS > 5220-49-5 3-Amino-2-cyclohexen-1-one
5220-49-5 3-Amino-2-cyclohexen-1-one
| product Name |
3-Amino-2-cyclohexen-1-one |
| CAS No |
5220-49-5 |
| Synonyms |
3-aminocyclohex-2-enone; 3-aminocyclohex-2-en-1-one; methyl 1-methyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropyrido[2,3-d]pyrimidine-5-carboxylate; (3E)-3-iminocyclohexanone; 3-AMINO-2-CYCLOHEXENE-1-ONE |
| Molecular Formula |
C6H9NO |
| Molecular Weight |
111.1418 |
| InChI |
InChI=1/C6H9NO/c7-5-2-1-3-6(8)4-5/h7H,1-4H2/b7-5+ |
| EINECS |
226-014-9 |
| Molecular Structure |
|
| Density |
1.17g/cm3 |
| Boiling point |
286.5°C at 760 mmHg |
| Refractive index |
1.558 |
| Flash point |
127.1°C |
| Vapour Pressur |
0.00263mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
