ChemNet > CAS > 22135-50-8 4-(4-methoxyphenyl)-1-butanol
22135-50-8 4-(4-methoxyphenyl)-1-butanol
| product Name |
4-(4-methoxyphenyl)-1-butanol |
| CAS No |
22135-50-8;52244-70-9 |
| Synonyms |
4-(4-methoxyphenyl)butan-1-ol; 1-(4-methoxyphenyl)butan-1-ol |
| Molecular Formula |
C11H16O2 |
| Molecular Weight |
180.2435 |
| InChI |
InChI=1/C11H16O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8,12H,2-4,9H2,1H3 |
| EINECS |
257-782-3 |
| Molecular Structure |
|
| Density |
1.019g/cm3 |
| Melting point |
3-4℃ |
| Boiling point |
304.7°C at 760 mmHg |
| Refractive index |
1.514 |
| Flash point |
130.9°C |
| Vapour Pressur |
0.000377mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
