ChemNet > CAS > 5228-48-8 2-Methyl-5-nitro-2H-indazole
5228-48-8 2-Methyl-5-nitro-2H-indazole
product Name |
2-Methyl-5-nitro-2H-indazole |
Synonyms |
Methylnitroindazole; 2-Methyl-5-nitro-1H-indazole |
Molecular Formula |
C8H7N3O2 |
Molecular Weight |
177.1601 |
InChI |
InChI=1/C8H7N3O2/c1-10-5-6-4-7(11(12)13)2-3-8(6)9-10/h2-5H,1H3 |
CAS Registry Number |
5228-48-8 |
Molecular Structure |
|
Density |
1.425g/cm3 |
Melting point |
161-163℃ |
Boiling point |
364.502°C at 760 mmHg |
Refractive index |
1.677 |
Flash point |
174.245°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|