ChemNet > CAS > 524-42-5 1,2-Naphthoquinone
524-42-5 1,2-Naphthoquinone
| product Name |
1,2-Naphthoquinone |
| CAS No |
524-42-5 |
| Synonyms |
1,2-Naphthalenedione; 1,2-naphthoquinone (beta); naphthalene-1,2-dione |
| Molecular Formula |
C10H6O2 |
| Molecular Weight |
158.1534 |
| InChI |
InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| EINECS |
208-360-2 |
| Molecular Structure |
|
| Density |
1.29g/cm3 |
| Melting point |
136-141℃ |
| Boiling point |
296.1°C at 760 mmHg |
| Refractive index |
1.617 |
| Flash point |
117.4°C |
| Vapour Pressur |
0.00147mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
