ChemNet > CAS > 52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
52431-30-8 2,5-Dibromo-3,4-dinitrothiophene
| product Name |
2,5-Dibromo-3,4-dinitrothiophene |
| CAS No |
52431-30-8 |
| Synonyms |
2,5-Dibromo-3,4-dinitrthiphene; AKOS 92299; 2,5-DIBROMO-3,4-DINITROTHIOPHENE 98+% |
| Molecular Formula |
C4Br2N2O4S |
| Molecular Weight |
331.9268 |
| InChI |
InChI=1/C4Br2N2O4S/c5-3-1(7(9)10)2(8(11)12)4(6)13-3 |
| Molecular Structure |
|
| Density |
2.459g/cm3 |
| Boiling point |
341.2°C at 760 mmHg |
| Refractive index |
1.716 |
| Flash point |
160.2°C |
| Vapour Pressur |
0.000161mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
