ChemNet > CAS > 526-73-8 1,2,3-Trimethylbenzene
526-73-8 1,2,3-Trimethylbenzene
| product Name |
1,2,3-Trimethylbenzene |
| CAS No |
526-73-8 |
| Synonyms |
hemimellitene |
| Molecular Formula |
C9H12 |
| Molecular Weight |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3 |
| EINECS |
208-394-8 |
| Molecular Structure |
|
| Density |
0.894 |
| Melting point |
-25℃ |
| Boiling point |
175-176℃ |
| Refractive index |
1.513 |
| Flash point |
53℃ |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R10:;
R37:;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
