ChemNet > CAS > 527-85-5 o-Toluamide
527-85-5 o-Toluamide
| product Name |
o-Toluamide |
| CAS No |
527-85-5 |
| Synonyms |
2-Methylbenzamide |
| Molecular Formula |
C8H9NO |
| Molecular Weight |
135.1632 |
| InChI |
InChI=1/C8H9NO/c1-6-4-2-3-5-7(6)8(9)10/h2-5H,1H3,(H2,9,10) |
| EINECS |
208-427-6 |
| Molecular Structure |
|
| Density |
1.086g/cm3 |
| Boiling point |
254.3°C at 760 mmHg |
| Refractive index |
1.556 |
| Flash point |
107.6°C |
| Vapour Pressur |
0.0174mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
