ChemNet > CAS > 52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
52708-32-4 4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline
| product Name |
4-(3,5-dimethyl-1H-pyrazol-1-yl)aniline |
| CAS No |
52708-32-4 |
| Molecular Formula |
C11H13N3 |
| Molecular Weight |
187.241 |
| InChI |
InChI=1/C11H13N3/c1-8-7-9(2)14(13-8)11-5-3-10(12)4-6-11/h3-7H,12H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.14g/cm3 |
| Melting point |
78℃ |
| Boiling point |
338.2°C at 760 mmHg |
| Refractive index |
1.611 |
| Flash point |
158.3°C |
| Vapour Pressur |
9.98E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
