ChemNet > CAS > 52768-17-9 4-(1H-pyrrol-1-yl)aniline
52768-17-9 4-(1H-pyrrol-1-yl)aniline
| product Name |
4-(1H-pyrrol-1-yl)aniline |
| CAS No |
52768-17-9 |
| Molecular Formula |
C10H10N2 |
| Molecular Weight |
158.1998 |
| InChI |
InChI=1/C10H10N2/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H,11H2 |
| Molecular Structure |
|
| Density |
1.09g/cm3 |
| Melting point |
80.7℃ |
| Boiling point |
307.8°C at 760 mmHg |
| Refractive index |
1.602 |
| Flash point |
140°C |
| Vapour Pressur |
0.000707mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
