ChemNet > CAS > 528-48-3 Fisetin
528-48-3 Fisetin
| product Name |
Fisetin |
| Synonyms |
C.I. 75620; C.I. Natural Brown 1; 3,3,4,7-Tetrahydroxyflavone; 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one |
| Molecular Formula |
C15H10O6 |
| Molecular Weight |
286.2363 |
| InChI |
InChI=1/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| CAS Registry Number |
528-48-3 |
| EINECS |
208-434-4 |
| Molecular Structure |
|
| Density |
1.688g/cm3 |
| Melting point |
330℃ |
| Boiling point |
599.4°C at 760 mmHg |
| Refractive index |
1.784 |
| Flash point |
233°C |
| Vapour Pressur |
3.23E-15mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Fisetin Material Safety Data Sheet
|
|
