ChemNet > CAS > 528-76-7 2,4-dinitrobenzenesulfenyl chloride
528-76-7 2,4-dinitrobenzenesulfenyl chloride
| product Name |
2,4-dinitrobenzenesulfenyl chloride |
| CAS No |
528-76-7 |
| Synonyms |
2,4-Dinitrophenylsulfenyl chloride; 2,4-Dinitrobenzenesulphenyl chloride; 1-(chlorosulfanyl)-2,4-dinitrobenzene |
| Molecular Formula |
C6H3ClN2O4S |
| Molecular Weight |
234.617 |
| InChI |
InChI=1/C6H3ClN2O4S/c7-14-6-2-1-4(8(10)11)3-5(6)9(12)13/h1-3H |
| EINECS |
208-441-2 |
| Molecular Structure |
|
| Density |
1.68g/cm3 |
| Melting point |
94-97℃ |
| Boiling point |
430.1°C at 760 mmHg |
| Refractive index |
1.662 |
| Flash point |
213.9°C |
| Vapour Pressur |
3.34E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
R37:Irritating to respiratory system.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
