ChemNet > CAS > 530-56-3 4-Hydroxy-3,5-dimethoxybenzyl alcohol
530-56-3 4-Hydroxy-3,5-dimethoxybenzyl alcohol
| product Name |
4-Hydroxy-3,5-dimethoxybenzyl alcohol |
| CAS No |
530-56-3 |
| Synonyms |
3,5-Dimethoxy-4-hydroxybenzyl alcohol~Syringic alcohol; Syringic alcohol; 4-(hydroxymethyl)-2,6-dimethoxyphenol |
| Molecular Formula |
C9H12O4 |
| Molecular Weight |
184.1892 |
| InChI |
InChI=1/C9H12O4/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,10-11H,5H2,1-2H3 |
| EINECS |
208-485-2 |
| Molecular Structure |
|
| Density |
1.23g/cm3 |
| Boiling point |
345.3°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
162.7°C |
| Vapour Pressur |
2.35E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
