ChemNet > CAS > 531-37-3 2-Methoxyphenylbenzoate,(Benzoicacid2-methoxyphenyl ester; Guaiacolbenzoate)
531-37-3 2-Methoxyphenylbenzoate,(Benzoicacid2-methoxyphenyl ester; Guaiacolbenzoate)
| product Name |
2-Methoxyphenylbenzoate,(Benzoicacid2-methoxyphenyl ester; Guaiacolbenzoate) |
| CAS No |
531-37-3 |
| Synonyms |
2-Methoxyphenyl benzoate; Benzoic acid 2-methoxyphenyl ester~Guaiacol benzoate |
| Molecular Formula |
C14H12O3 |
| Molecular Weight |
228.2433 |
| InChI |
InChI=1/C14H12O3/c1-16-12-9-5-6-10-13(12)17-14(15)11-7-3-2-4-8-11/h2-10H,1H3 |
| EINECS |
208-507-0 |
| Molecular Structure |
|
| Density |
1.159g/cm3 |
| Boiling point |
390.4°C at 760 mmHg |
| Refractive index |
1.569 |
| Flash point |
164.6°C |
| Vapour Pressur |
2.66E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
