ChemNet > CAS > 5321-49-3 1-(2-Phenylethyl)piperazine
5321-49-3 1-(2-Phenylethyl)piperazine
| product Name |
1-(2-Phenylethyl)piperazine |
| CAS No |
5321-49-3 |
| Synonyms |
1-(Phenethyl)piperazine; 1-phenylethyl piperazine; N-(2-Phenylethyl)piperazine; 1-(2-cyclohexylethyl)piperazinediium |
| Molecular Formula |
C12H26N2 |
| Molecular Weight |
198.3471 |
| InChI |
InChI=1/C12H24N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h12-13H,1-11H2/p+2 |
| EINECS |
226-186-5 |
| Molecular Structure |
|
| Boiling point |
277.1°C at 760 mmHg |
| Flash point |
99°C |
| Vapour Pressur |
0.00462mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
