ChemNet > CAS > 53218-26-1 6-bromo-1,3-benzothiazole
53218-26-1 6-bromo-1,3-benzothiazole
| product Name |
6-bromo-1,3-benzothiazole |
| CAS No |
53218-26-1 |
| Synonyms |
6-Bromobenzothiazole; 6-bromobenzo[d]thiazole |
| Molecular Formula |
C7H4BrNS |
| Molecular Weight |
214.0824 |
| InChI |
InChI=1/C7H4BrNS/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H |
| Molecular Structure |
|
| Density |
1.748g/cm3 |
| Melting point |
52℃ |
| Boiling point |
291.493°C at 760 mmHg |
| Refractive index |
1.718 |
| Flash point |
130.09°C |
| Vapour Pressur |
0.003mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
