ChemNet > CAS > 5323-87-5 3-Ethoxy-2-cyclohexen-1-one
5323-87-5 3-Ethoxy-2-cyclohexen-1-one
| product Name |
3-Ethoxy-2-cyclohexen-1-one |
| CAS No |
5323-87-5 |
| Synonyms |
3-Ethoxy-2-cyclohexene-1-one; 3-ethoxycyclohex-2-en-1-one |
| Molecular Formula |
C8H12O2 |
| Molecular Weight |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-2-10-8-5-3-4-7(9)6-8/h6H,2-5H2,1H3 |
| EINECS |
226-190-7 |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Boiling point |
250.1°C at 760 mmHg |
| Refractive index |
1.467 |
| Flash point |
107.2°C |
| Vapour Pressur |
0.022mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
