ChemNet > CAS > 53266-92-5 ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride
53266-92-5 ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride
| product Name |
ethyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate hydrochloride |
| CAS No |
53266-92-5 |
| Molecular Formula |
C7H11ClN2O2S |
| Molecular Weight |
222.6924 |
| InChI |
InChI=1/C7H10N2O2S.ClH/c1-3-11-6(10)5-4(2)9-7(8)12-5;/h3H2,1-2H3,(H2,8,9);1H |
| Molecular Structure |
|
| Melting point |
215℃ |
| Boiling point |
313.1°C at 760 mmHg |
| Flash point |
143.1°C |
| Vapour Pressur |
0.000508mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
