ChemNet > CAS > 53279-72-4 3-Hydroxy-2,4,6-triiodobenzoic acid
53279-72-4 3-Hydroxy-2,4,6-triiodobenzoic acid
| product Name |
3-Hydroxy-2,4,6-triiodobenzoic acid |
| CAS No |
53279-72-4 |
| Synonyms |
2,4,6-Triiodo-3-hydroxybenzoic acid; 3-hydroxy-2,4,6-triiodobenzoate; HTBA |
| Molecular Formula |
C7H2I3O3 |
| Molecular Weight |
514.8029 |
| InChI |
InChI=1/C7H3I3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13)/p-1 |
| EINECS |
258-457-9 |
| Molecular Structure |
|
| Boiling point |
389.2°C at 760 mmHg |
| Flash point |
189.2°C |
| Vapour Pressur |
9.38E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
