ChemNet > CAS > 5328-01-8 1-Ethoxynaphthalene
5328-01-8 1-Ethoxynaphthalene
| product Name |
1-Ethoxynaphthalene |
| Synonyms |
Ethyl 1-naphthyl ether; Ethyl alpha-naphthyl ether; ; alpha-Ethoxynaphthalene; Naphthalene, 1-ethoxy-; 1-Naphthol ethyl ether; Naphtholethylether |
| Molecular Formula |
C12H12O |
| Molecular Weight |
172.2231 |
| InChI |
InChI=1/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| CAS Registry Number |
5328-01-8 |
| EINECS |
226-213-0 |
| Molecular Structure |
|
| Density |
1.049g/cm3 |
| Boiling point |
280.5°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
109.4°C |
| Vapour Pressur |
0.00641mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
