ChemNet > CAS > 5331-92-0 3,4-dichlorobenzaldehyde oxime
5331-92-0 3,4-dichlorobenzaldehyde oxime
| product Name |
3,4-dichlorobenzaldehyde oxime |
| CAS No |
5331-92-0 |
| Synonyms |
3,4-Dichlorobenzaldoxime |
| Molecular Formula |
C7H5Cl2NO |
| Molecular Weight |
190.0267 |
| InChI |
InChI=1/C7H5Cl2NO/c8-6-2-1-5(4-10-11)3-7(6)9/h1-4,11H/b10-4+ |
| Molecular Structure |
|
| Density |
1.38g/cm3 |
| Melting point |
118℃ |
| Boiling point |
278.2°C at 760 mmHg |
| Refractive index |
1.575 |
| Flash point |
122.1°C |
| Vapour Pressur |
0.00207mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
